C31H27NO6S — CID 11364723
2-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(naphthalen-2-ylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione (PubChem CID 11364723) has the molecular formula C31H27NO6S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(naphthalen-2-ylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(naphthalen-2-ylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11364723 |
| Molecular Formula | C31H27NO6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(naphthalen-2-ylmethoxymethyl)-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1[C@@H](O)[C@H](O)[C@@H](COCc2ccc3ccccc3c2)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C31H27NO6S/c33-27-25(18-37-17-19-14-15-20-8-4-5-9-21(20)16-19)38-31(39-22-10-2-1-3-11-22)26(28(27)34)32-29(35)23-12-6-7-13-24(23)30(32)36/h1-16,25-28,31,33-34H,17-18H2/t25-,26-,27-,28-,31+/m1/s1 |
| InChIKey | FHONSYMHEXHTCB-QWCZOQLWSA-N |
| XLogP | 4.26 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|