C31H29NO5S — CID 101452876
(3aR,4R,6R,7S,7aR)-7-hydroxy-3-(naphthalen-1-ylmethyl)-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 101452876) has the molecular formula C31H29NO5S and a molecular weight of 527.64 g/mol. Its IUPAC name is (3aR,4R,6R,7S,7aR)-7-hydroxy-3-(naphthalen-1-ylmethyl)-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,4R,6R,7S,7aR)-7-hydroxy-3-(naphthalen-1-ylmethyl)-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 101452876 |
| Molecular Formula | C31H29NO5S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (3aR,4R,6R,7S,7aR)-7-hydroxy-3-(naphthalen-1-ylmethyl)-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@H]2[C@H](O)[C@@H](COCc3ccccc3)O[C@H](Sc3ccccc3)[C@@H]2N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C31H29NO5S/c33-28-26(20-35-19-21-10-3-1-4-11-21)36-30(38-24-15-5-2-6-16-24)27-29(28)37-31(34)32(27)18-23-14-9-13-22-12-7-8-17-25(22)23/h1-17,26-30,33H,18-20H2/t26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | BNCRJLUHJFUHBT-XZTOTZIXSA-N |
| XLogP | 5.62 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |