C27H26N2O7S — CID 101452871
(3aR,4S,6R,7S,7aR)-7-hydroxy-3-[(2-nitrophenyl)methyl]-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 101452871) has the molecular formula C27H26N2O7S and a molecular weight of 522.58 g/mol. Its IUPAC name is (3aR,4S,6R,7S,7aR)-7-hydroxy-3-[(2-nitrophenyl)methyl]-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,4S,6R,7S,7aR)-7-hydroxy-3-[(2-nitrophenyl)methyl]-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 101452871 |
| Molecular Formula | C27H26N2O7S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (3aR,4S,6R,7S,7aR)-7-hydroxy-3-[(2-nitrophenyl)methyl]-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@H]2[C@H](O)[C@@H](COCc3ccccc3)O[C@@H](Sc3ccccc3)[C@@H]2N1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26N2O7S/c30-24-22(17-34-16-18-9-3-1-4-10-18)35-26(37-20-12-5-2-6-13-20)23-25(24)36-27(31)28(23)15-19-11-7-8-14-21(19)29(32)33/h1-14,22-26,30H,15-17H2/t22-,23-,24-,25-,26+/m1/s1 |
| InChIKey | KOLCXIFFXMCREX-SDVOOXDOSA-N |
| XLogP | 4.38 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|