C40H41NO10S — CID 71725166
[(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-5-[2-(2-nitrophenyl)acetyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate (PubChem CID 71725166) has the molecular formula C40H41NO10S and a molecular weight of 727.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-5-[2-(2-nitrophenyl)acetyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-5-[2-(2-nitrophenyl)acetyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 71725166 |
| Molecular Formula | C40H41NO10S |
| Molecular Weight | 727.83 g/mol |
| Exact Mass | 727.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(4-methylphenyl)sulfanyl-5-[2-(2-nitrophenyl)acetyl]oxy-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](OC(=O)Cc2ccccc2[N+](=O)[O-])[C@H](Sc2ccc(C)cc2)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C40H41NO10S/c1-27-17-20-32(21-18-27)52-40-39(51-36(44)23-31-15-9-10-16-33(31)41(45)46)38(48-25-30-13-7-4-8-14-30)37(50-35(43)22-19-28(2)42)34(49-40)26-47-24-29-11-5-3-6-12-29/h3-18,20-21,34,37-40H,19,22-26H2,1-2H3/t34-,37-,38+,39-,40+/m1/s1 |
| InChIKey | NOVFCWSQEOLAMF-JCWJTLRKSA-N |
| XLogP | 6.96 |
| TPSA | 140.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|