C16H16O5S — CID 54490714
2-(2-ethylsulfonyl-4-phenylphenyl)-2-hydroxyacetic acid (PubChem CID 54490714) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(2-ethylsulfonyl-4-phenylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-ethylsulfonyl-4-phenylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 54490714 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(2-ethylsulfonyl-4-phenylphenyl)-2-hydroxyacetic acid |
| SMILES | CCS(=O)(=O)c1cc(-c2ccccc2)ccc1C(O)C(=O)O |
| InChI | InChI=1S/C16H16O5S/c1-2-22(20,21)14-10-12(11-6-4-3-5-7-11)8-9-13(14)15(17)16(18)19/h3-10,15,17H,2H2,1H3,(H,18,19) |
| InChIKey | XVNBQWKQXUCJPX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |