C13H11Cl2NO2S2 — CID 54492459
3-phenylpropyl (4,5-dichloro-1,3-thiazol-2-yl)sulfanylformate (PubChem CID 54492459) has the molecular formula C13H11Cl2NO2S2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 3-phenylpropyl (4,5-dichloro-1,3-thiazol-2-yl)sulfanylformate.
| Compound Name | 3-phenylpropyl (4,5-dichloro-1,3-thiazol-2-yl)sulfanylformate |
|---|---|
| PubChem CID | 54492459 |
| Molecular Formula | C13H11Cl2NO2S2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 3-phenylpropyl (4,5-dichloro-1,3-thiazol-2-yl)sulfanylformate |
| SMILES | O=C(OCCCc1ccccc1)Sc1nc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C13H11Cl2NO2S2/c14-10-11(15)19-12(16-10)20-13(17)18-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | XWRRFUQKFIGBFP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|