C27H36N4O7 — CID 54492544
tert-butyl N-[(2S)-1-[[(2S,3S)-1-amino-3-hydroxy-1-oxobutan-2-yl]-[(2R)-1-phenylpropan-2-yl]amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 54492544) has the molecular formula C27H36N4O7 and a molecular weight of 528.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S,3S)-1-amino-3-hydroxy-1-oxobutan-2-yl]-[(2R)-1-phenylpropan-2-yl]amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S,3S)-1-amino-3-hydroxy-1-oxobutan-2-yl]-[(2R)-1-phenylpropan-2-yl]amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54492544 |
| Molecular Formula | C27H36N4O7 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S,3S)-1-amino-3-hydroxy-1-oxobutan-2-yl]-[(2R)-1-phenylpropan-2-yl]amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](O)[C@@H](C(N)=O)N(C(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C27H36N4O7/c1-17(15-19-9-7-6-8-10-19)30(23(18(2)32)24(28)33)25(34)22(29-26(35)38-27(3,4)5)16-20-11-13-21(14-12-20)31(36)37/h6-14,17-18,22-23,32H,15-16H2,1-5H3,(H2,28,33)(H,29,35)/t17-,18+,22+,23+/m1/s1 |
| InChIKey | XWTBURLFBBHXPS-PNQHUFSXSA-N |
| XLogP | 2.73 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|