C21H37N — CID 54493704
3,4-di(cyclooctyl)-2,3,4,5-tetrahydropyridine (PubChem CID 54493704) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is 3,4-di(cyclooctyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 3,4-di(cyclooctyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 54493704 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | 3,4-di(cyclooctyl)-2,3,4,5-tetrahydropyridine |
| SMILES | C1=NCC(C2CCCCCCC2)C(C2CCCCCCC2)C1 |
| InChI | InChI=1S/C21H37N/c1-3-7-11-18(12-8-4-1)20-15-16-22-17-21(20)19-13-9-5-2-6-10-14-19/h16,18-21H,1-15,17H2 |
| InChIKey | KZGZAIVLIBQVPT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |