C17H23F5OS — CID 54495353
pentafluoro-[4-(4-propoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane (PubChem CID 54495353) has the molecular formula C17H23F5OS and a molecular weight of 370.43 g/mol. Its IUPAC name is pentafluoro-[4-(4-propoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-(4-propoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 54495353 |
| Molecular Formula | C17H23F5OS |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | pentafluoro-[4-(4-propoxy-1-bicyclo[2.2.2]octanyl)phenyl]-λ6-sulfane |
| SMILES | CCCOC12CCC(c3ccc(S(F)(F)(F)(F)F)cc3)(CC1)CC2 |
| InChI | InChI=1S/C17H23F5OS/c1-2-13-23-17-10-7-16(8-11-17,9-12-17)14-3-5-15(6-4-14)24(18,19,20,21)22/h3-6H,2,7-13H2,1H3 |
| InChIKey | XYRGBSQKLFWKAM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |