C22H28N2 — CID 54498464
1,4-diphenyl-3-prop-1-enylpyrazole;ethane (PubChem CID 54498464) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1,4-diphenyl-3-prop-1-enylpyrazole;ethane.
| Compound Name | 1,4-diphenyl-3-prop-1-enylpyrazole;ethane |
|---|---|
| PubChem CID | 54498464 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1,4-diphenyl-3-prop-1-enylpyrazole;ethane |
| SMILES | CC.CC.CC=Cc1nn(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C18H16N2.2C2H6/c1-2-9-18-17(15-10-5-3-6-11-15)14-20(19-18)16-12-7-4-8-13-16;2*1-2/h2-14H,1H3;2*1-2H3 |
| InChIKey | YATRYZGSDLBXDJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |