C27H48O4Si — CID 54500144
2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 54500144) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54500144 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CCCC1=CCC(O)[C@@H]1CC=CCCC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C27H48O4Si/c1-7-14-21-18-19-24(28)23(21)17-12-9-13-20-27(25(29)30,22-15-10-8-11-16-22)31-32(5,6)26(2,3)4/h9,12,18,22-24,28H,7-8,10-11,13-17,19-20H2,1-6H3,(H,29,30)/t23-,24?,27?/m1/s1 |
| InChIKey | YBVNOXVATMXKKB-MNEVETPYSA-N |
| XLogP | 7.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|