C14H17ClO2 — CID 54502240
3-[2-chloro-2-(4-ethoxyphenyl)ethenyl]-2,2-dimethyloxirane (PubChem CID 54502240) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-[2-chloro-2-(4-ethoxyphenyl)ethenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[2-chloro-2-(4-ethoxyphenyl)ethenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 54502240 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-[2-chloro-2-(4-ethoxyphenyl)ethenyl]-2,2-dimethyloxirane |
| SMILES | CCOc1ccc(C(Cl)=CC2OC2(C)C)cc1 |
| InChI | InChI=1S/C14H17ClO2/c1-4-16-11-7-5-10(6-8-11)12(15)9-13-14(2,3)17-13/h5-9,13H,4H2,1-3H3 |
| InChIKey | YDFYDJYSQLQHNA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|