C29H32O3 — CID 154202721
1-[1,4-bis(4-ethoxyphenyl)penta-1,3-dienyl]-4-ethoxybenzene (PubChem CID 154202721) has the molecular formula C29H32O3 and a molecular weight of 428.57 g/mol. Its IUPAC name is 1-[1,4-bis(4-ethoxyphenyl)penta-1,3-dienyl]-4-ethoxybenzene.
| Compound Name | 1-[1,4-bis(4-ethoxyphenyl)penta-1,3-dienyl]-4-ethoxybenzene |
|---|---|
| PubChem CID | 154202721 |
| Molecular Formula | C29H32O3 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[1,4-bis(4-ethoxyphenyl)penta-1,3-dienyl]-4-ethoxybenzene |
| SMILES | CCOc1ccc(C(C)=CC=C(c2ccc(OCC)cc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C29H32O3/c1-5-30-26-15-9-23(10-16-26)22(4)8-21-29(24-11-17-27(18-12-24)31-6-2)25-13-19-28(20-14-25)32-7-3/h8-21H,5-7H2,1-4H3 |
| InChIKey | ZVHLNFHDJUQTGG-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|