C14H23N3O — CID 178030226
ethane;(3Z)-4-(4-ethoxyphenyl)buta-1,3-diene-1,1,4-triamine (PubChem CID 178030226) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is ethane;(3Z)-4-(4-ethoxyphenyl)buta-1,3-diene-1,1,4-triamine.
| Compound Name | ethane;(3Z)-4-(4-ethoxyphenyl)buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 178030226 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | ethane;(3Z)-4-(4-ethoxyphenyl)buta-1,3-diene-1,1,4-triamine |
| SMILES | CC.CCOc1ccc(/C(N)=C/C=C(N)N)cc1 |
| InChI | InChI=1S/C12H17N3O.C2H6/c1-2-16-10-5-3-9(4-6-10)11(13)7-8-12(14)15;1-2/h3-8H,2,13-15H2,1H3;1-2H3/b11-7-; |
| InChIKey | KOQCLCDOGBTVSO-AJULUCINSA-N |
| XLogP | 2.17 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|