C16H22O2 — CID 142927159
1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene (PubChem CID 142927159) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene.
| Compound Name | 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142927159 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene |
| SMILES | CCOc1ccc(/C(C)=C/C=C(\CC)OC)cc1 |
| InChI | InChI=1S/C16H22O2/c1-5-15(17-4)10-7-13(3)14-8-11-16(12-9-14)18-6-2/h7-12H,5-6H2,1-4H3/b13-7+,15-10+ |
| InChIKey | VLAAPOIKUAYIDC-OOVVNSOSSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|