About 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene
1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene (PubChem CID 142927159) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene.
Molecular Properties
| Compound Name | 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene |
| PubChem CID | 142927159 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene |
| SMILES | CCOc1ccc(/C(C)=C/C=C(\CC)OC)cc1 |
| InChI | InChI=1S/C16H22O2/c1-5-15(17-4)10-7-13(3)14-8-11-16(12-9-14)18-6-2/h7-12H,5-6H2,1-4H3/b13-7+,15-10+ |
| InChIKey | VLAAPOIKUAYIDC-OOVVNSOSSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene?
The IUPAC name of 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene (CID 142927159) is 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene.
What is the SMILES notation for 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene?
The canonical SMILES for 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene is CCOc1ccc(/C(C)=C/C=C(\CC)OC)cc1.
What is the InChIKey of 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene?
The InChIKey is VLAAPOIKUAYIDC-OOVVNSOSSA-N. The full InChI is InChI=1S/C16H22O2/c1-5-15(17-4)10-7-13(3)14-8-11-16(12-9-14)18-6-2/h7-12H,5-6H2,1-4H3/b13-7+,15-10+.
What are the key properties of 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene?
1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene has a molecular weight of 246.35 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-[(2E,4E)-5-methoxyhepta-2,4-dien-2-yl]benzene is sourced from PubChem (CID 142927159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).