C18H26N2O12 — CID 54504694
(2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]butanoic acid (PubChem CID 54504694) has the molecular formula C18H26N2O12 and a molecular weight of 462.41 g/mol. Its IUPAC name is (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 54504694 |
| Molecular Formula | C18H26N2O12 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (2S)-2-amino-4-oxo-4-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]butanoic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)C[C@H](N)C(=O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H26N2O12/c1-7(21)28-6-12-14(29-8(2)22)15(30-9(3)23)16(31-10(4)24)17(32-12)20-13(25)5-11(19)18(26)27/h11-12,14-17H,5-6,19H2,1-4H3,(H,20,25)(H,26,27)/t11-,12+,14+,15-,16+,17+/m0/s1 |
| InChIKey | YEWCXCCLSDOCBO-HJIDVSFMSA-N |
| XLogP | -2.01 |
| TPSA | 206.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|