About [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate
[2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate (PubChem CID 54506260) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate |
| PubChem CID | 54506260 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccccc1COCc1ccco1 |
| InChI | InChI=1S/C14H15NO4/c1-15-14(16)19-13-7-3-2-5-11(13)9-17-10-12-6-4-8-18-12/h2-8H,9-10H2,1H3,(H,15,16) |
| InChIKey | YFXXJQOOWLERHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate?
The IUPAC name of [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate (CID 54506260) is [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate.
What is the SMILES notation for [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate?
The canonical SMILES for [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate is CNC(=O)Oc1ccccc1COCc1ccco1.
What is the InChIKey of [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate?
The InChIKey is YFXXJQOOWLERHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-15-14(16)19-13-7-3-2-5-11(13)9-17-10-12-6-4-8-18-12/h2-8H,9-10H2,1H3,(H,15,16).
What are the key properties of [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate?
[2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate has a molecular weight of 261.28 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-ylmethoxymethyl)phenyl] N-methylcarbamate is sourced from PubChem (CID 54506260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).