C31H21NO3 — CID 54508466
[5-benzoyl-2-(1,2-diphenylethenyl)-1,3-oxazol-4-yl]-phenylmethanone (PubChem CID 54508466) has the molecular formula C31H21NO3 and a molecular weight of 455.51 g/mol. Its IUPAC name is [5-benzoyl-2-(1,2-diphenylethenyl)-1,3-oxazol-4-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-2-(1,2-diphenylethenyl)-1,3-oxazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54508466 |
| Molecular Formula | C31H21NO3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [5-benzoyl-2-(1,2-diphenylethenyl)-1,3-oxazol-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1nc(C(=Cc2ccccc2)c2ccccc2)oc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H21NO3/c33-28(24-17-9-3-10-18-24)27-30(29(34)25-19-11-4-12-20-25)35-31(32-27)26(23-15-7-2-8-16-23)21-22-13-5-1-6-14-22/h1-21H |
| InChIKey | YHKHSIKJUYIJEE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|