C11H13BrN2O5S — CID 54513330
(6S,7S)-7-acetamido-3-(bromomethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54513330) has the molecular formula C11H13BrN2O5S and a molecular weight of 365.21 g/mol. Its IUPAC name is (6S,7S)-7-acetamido-3-(bromomethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-acetamido-3-(bromomethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54513330 |
| Molecular Formula | C11H13BrN2O5S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | (6S,7S)-7-acetamido-3-(bromomethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(C)=O)C(=O)N2C(C(=O)O)=C(CBr)CS[C@H]21 |
| InChI | InChI=1S/C11H13BrN2O5S/c1-5(15)13-11(19-2)9(18)14-7(8(16)17)6(3-12)4-20-10(11)14/h10H,3-4H2,1-2H3,(H,13,15)(H,16,17)/t10-,11-/m0/s1 |
| InChIKey | YKRLPKUGNMBYQL-QWRGUYRKSA-N |
| XLogP | 0.11 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|