C11H12BrN5O5S — CID 139720237
(6R,7S)-3-(azidomethyl)-7-[(2-bromoacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139720237) has the molecular formula C11H12BrN5O5S and a molecular weight of 406.22 g/mol. Its IUPAC name is (6R,7S)-3-(azidomethyl)-7-[(2-bromoacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-(azidomethyl)-7-[(2-bromoacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139720237 |
| Molecular Formula | C11H12BrN5O5S |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | (6R,7S)-3-(azidomethyl)-7-[(2-bromoacetyl)amino]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)CBr)C(=O)N2C(C(=O)O)=C(CN=[N+]=[N-])CS[C@@H]21 |
| InChI | InChI=1S/C11H12BrN5O5S/c1-22-11(15-6(18)2-12)9(21)17-7(8(19)20)5(3-14-16-13)4-23-10(11)17/h10H,2-4H2,1H3,(H,15,18)(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | XQTLWAQQPXXSHK-MNOVXSKESA-N |
| XLogP | 0.40 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|