C25H21Cl2N3O3 — CID 54514892
2-chloro-N-[[4-[[[(4-chlorophenyl)-cyclopropylmethylidene]amino]oxymethyl]phenyl]carbamoyl]benzamide (PubChem CID 54514892) has the molecular formula C25H21Cl2N3O3 and a molecular weight of 482.37 g/mol. Its IUPAC name is 2-chloro-N-[[4-[[[(4-chlorophenyl)-cyclopropylmethylidene]amino]oxymethyl]phenyl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[4-[[[(4-chlorophenyl)-cyclopropylmethylidene]amino]oxymethyl]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 54514892 |
| Molecular Formula | C25H21Cl2N3O3 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-chloro-N-[[4-[[[(4-chlorophenyl)-cyclopropylmethylidene]amino]oxymethyl]phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1ccc(CON=C(c2ccc(Cl)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O3/c26-19-11-9-18(10-12-19)23(17-7-8-17)30-33-15-16-5-13-20(14-6-16)28-25(32)29-24(31)21-3-1-2-4-22(21)27/h1-6,9-14,17H,7-8,15H2,(H2,28,29,31,32) |
| InChIKey | YLSPANCFRQFNMM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|