C34H38N2O4 — CID 54515381
(2S,3S,4S)-4-(1-benzofuran-5-yl)-2-(4-ethylphenyl)-1-[2-[4-(3-methylphenyl)butylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 54515381) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is (2S,3S,4S)-4-(1-benzofuran-5-yl)-2-(4-ethylphenyl)-1-[2-[4-(3-methylphenyl)butylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S,4S)-4-(1-benzofuran-5-yl)-2-(4-ethylphenyl)-1-[2-[4-(3-methylphenyl)butylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54515381 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (2S,3S,4S)-4-(1-benzofuran-5-yl)-2-(4-ethylphenyl)-1-[2-[4-(3-methylphenyl)butylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCc1ccc([C@@H]2[C@@H](C(=O)O)[C@@H](c3ccc4occc4c3)CN2CC(=O)NCCCCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C34H38N2O4/c1-3-24-10-12-26(13-11-24)33-32(34(38)39)29(27-14-15-30-28(20-27)16-18-40-30)21-36(33)22-31(37)35-17-5-4-8-25-9-6-7-23(2)19-25/h6-7,9-16,18-20,29,32-33H,3-5,8,17,21-22H2,1-2H3,(H,35,37)(H,38,39)/t29-,32+,33-/m1/s1 |
| InChIKey | YMBKVIZCUFKMFG-KINHPLIHSA-N |
| XLogP | 6.28 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|