C12H25ClN2O — CID 54515899
2-(3-chloro-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-N,N-diethylethanamine (PubChem CID 54515899) has the molecular formula C12H25ClN2O and a molecular weight of 248.80 g/mol. Its IUPAC name is 2-(3-chloro-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-N,N-diethylethanamine.
| Compound Name | 2-(3-chloro-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 54515899 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-(3-chloro-2,4,4-trimethyl-1,3-oxazolidin-2-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCC1(C)OCC(C)(C)N1Cl |
| InChI | InChI=1S/C12H25ClN2O/c1-6-14(7-2)9-8-12(5)15(13)11(3,4)10-16-12/h6-10H2,1-5H3 |
| InChIKey | YMJSYAWXHJXNMG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|