About bis[2-(diethylamino)ethyl]azanide;vanadium
bis[2-(diethylamino)ethyl]azanide;vanadium (PubChem CID 147184537) has the molecular formula C12H28N3V-
and a molecular weight of 265.32 g/mol. Its IUPAC name is bis[2-(diethylamino)ethyl]azanide;vanadium.
Molecular Properties
| Compound Name | bis[2-(diethylamino)ethyl]azanide;vanadium |
| PubChem CID | 147184537 |
| Molecular Formula | C12H28N3V- |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | bis[2-(diethylamino)ethyl]azanide;vanadium |
| SMILES | CCN(CC)CC[N-]CCN(CC)CC.[V] |
| InChI | InChI=1S/C12H28N3.V/c1-5-14(6-2)11-9-13-10-12-15(7-3)8-4;/h5-12H2,1-4H3;/q-1; |
| InChIKey | AQEHLLXVIJUOCT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(diethylamino)ethyl]azanide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(diethylamino)ethyl]azanide;vanadium?
The IUPAC name of bis[2-(diethylamino)ethyl]azanide;vanadium (CID 147184537) is bis[2-(diethylamino)ethyl]azanide;vanadium.
What is the SMILES notation for bis[2-(diethylamino)ethyl]azanide;vanadium?
The canonical SMILES for bis[2-(diethylamino)ethyl]azanide;vanadium is CCN(CC)CC[N-]CCN(CC)CC.[V].
What is the InChIKey of bis[2-(diethylamino)ethyl]azanide;vanadium?
The InChIKey is AQEHLLXVIJUOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N3.V/c1-5-14(6-2)11-9-13-10-12-15(7-3)8-4;/h5-12H2,1-4H3;/q-1;.
What are the key properties of bis[2-(diethylamino)ethyl]azanide;vanadium?
bis[2-(diethylamino)ethyl]azanide;vanadium has a molecular weight of 265.32 g/mol, XLogP of 2.04, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(diethylamino)ethyl]azanide;vanadium is sourced from PubChem (CID 147184537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).