About 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium
2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium (PubChem CID 3731614) has the molecular formula C13H30CoN3O2+4
and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium.
Molecular Properties
| Compound Name | 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium |
| PubChem CID | 3731614 |
| Molecular Formula | C13H30CoN3O2+4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium |
| SMILES | CCN(CC)CC[N-]CCN.[Co+3].[H]/[O+]=C(/C)C=C(C)[OH2+] |
| InChI | InChI=1S/C8H20N3.C5H8O2.Co/c1-3-11(4-2)8-7-10-6-5-9;1-4(6)3-5(2)7;/h3-9H2,1-2H3;3,6H,1-2H3;/q-1;;+3/p+2 |
| InChIKey | WCUXVQMDCQWFGM-UHFFFAOYSA-P |
| XLogP | 0.84 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium?
The IUPAC name of 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium (CID 3731614) is 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium.
What is the SMILES notation for 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium?
The canonical SMILES for 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium is CCN(CC)CC[N-]CCN.[Co+3].[H]/[O+]=C(/C)C=C(C)[OH2+].
What is the InChIKey of 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium?
The InChIKey is WCUXVQMDCQWFGM-UHFFFAOYSA-P. The full InChI is InChI=1S/C8H20N3.C5H8O2.Co/c1-3-11(4-2)8-7-10-6-5-9;1-4(6)3-5(2)7;/h3-9H2,1-2H3;3,6H,1-2H3;/q-1;;+3/p+2.
What are the key properties of 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium?
2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium has a molecular weight of 319.33 g/mol, XLogP of 0.84, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl-[2-(diethylamino)ethyl]azanide;cobalt(3+);4-oxoniopent-3-en-2-ylideneoxidanium is sourced from PubChem (CID 3731614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).