C11H28N4 — CID 67567532
N',N'-diethylpropane-1,3-diamine;piperazine (PubChem CID 67567532) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is N',N'-diethylpropane-1,3-diamine;piperazine.
| Compound Name | N',N'-diethylpropane-1,3-diamine;piperazine |
|---|---|
| PubChem CID | 67567532 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | N',N'-diethylpropane-1,3-diamine;piperazine |
| SMILES | C1CNCCN1.CCN(CC)CCCN |
| InChI | InChI=1S/C7H18N2.C4H10N2/c1-3-9(4-2)7-5-6-8;1-2-6-4-3-5-1/h3-8H2,1-2H3;5-6H,1-4H2 |
| InChIKey | MCZWQHSLORBSIX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |