About N',N'-diethylpropane-1,3-diamine;piperazine
N',N'-diethylpropane-1,3-diamine;piperazine (PubChem CID 67567532) has the molecular formula C11H28N4
and a molecular weight of 216.37 g/mol. Its IUPAC name is N',N'-diethylpropane-1,3-diamine;piperazine.
Molecular Properties
| Compound Name | N',N'-diethylpropane-1,3-diamine;piperazine |
| PubChem CID | 67567532 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | N',N'-diethylpropane-1,3-diamine;piperazine |
| SMILES | C1CNCCN1.CCN(CC)CCCN |
| InChI | InChI=1S/C7H18N2.C4H10N2/c1-3-9(4-2)7-5-6-8;1-2-6-4-3-5-1/h3-8H2,1-2H3;5-6H,1-4H2 |
| InChIKey | MCZWQHSLORBSIX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-diethylpropane-1,3-diamine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethylpropane-1,3-diamine;piperazine?
The IUPAC name of N',N'-diethylpropane-1,3-diamine;piperazine (CID 67567532) is N',N'-diethylpropane-1,3-diamine;piperazine.
What is the SMILES notation for N',N'-diethylpropane-1,3-diamine;piperazine?
The canonical SMILES for N',N'-diethylpropane-1,3-diamine;piperazine is C1CNCCN1.CCN(CC)CCCN.
What is the InChIKey of N',N'-diethylpropane-1,3-diamine;piperazine?
The InChIKey is MCZWQHSLORBSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.C4H10N2/c1-3-9(4-2)7-5-6-8;1-2-6-4-3-5-1/h3-8H2,1-2H3;5-6H,1-4H2.
What are the key properties of N',N'-diethylpropane-1,3-diamine;piperazine?
N',N'-diethylpropane-1,3-diamine;piperazine has a molecular weight of 216.37 g/mol, XLogP of -0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethylpropane-1,3-diamine;piperazine is sourced from PubChem (CID 67567532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).