C21H21NO3 — CID 54517477
tert-butyl 8-oxo-7-(pyridin-3-ylmethylidene)-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 54517477) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl 8-oxo-7-(pyridin-3-ylmethylidene)-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | tert-butyl 8-oxo-7-(pyridin-3-ylmethylidene)-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54517477 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl 8-oxo-7-(pyridin-3-ylmethylidene)-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)C(=O)C(=Cc1cccnc1)CC2 |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)25-20(24)17-9-7-15-6-8-16(19(23)18(15)12-17)11-14-5-4-10-22-13-14/h4-5,7,9-13H,6,8H2,1-3H3 |
| InChIKey | YNJZVHIWWLVDTJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|