C13H6ClF5O3S — CID 54521867
1-chloro-2,3,5,6-tetrafluoro-4-(3-fluoro-4-methoxyphenyl)sulfonylbenzene (PubChem CID 54521867) has the molecular formula C13H6ClF5O3S and a molecular weight of 372.70 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetrafluoro-4-(3-fluoro-4-methoxyphenyl)sulfonylbenzene.
| Compound Name | 1-chloro-2,3,5,6-tetrafluoro-4-(3-fluoro-4-methoxyphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 54521867 |
| Molecular Formula | C13H6ClF5O3S |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 1-chloro-2,3,5,6-tetrafluoro-4-(3-fluoro-4-methoxyphenyl)sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2c(F)c(F)c(Cl)c(F)c2F)cc1F |
| InChI | InChI=1S/C13H6ClF5O3S/c1-22-7-3-2-5(4-6(7)15)23(20,21)13-11(18)9(16)8(14)10(17)12(13)19/h2-4H,1H3 |
| InChIKey | YQJKJBOCHFOKIB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|