C13H7F5O4S — CID 54499987
2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)sulfonylphenol (PubChem CID 54499987) has the molecular formula C13H7F5O4S and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)sulfonylphenol.
| Compound Name | 2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)sulfonylphenol |
|---|---|
| PubChem CID | 54499987 |
| Molecular Formula | C13H7F5O4S |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)sulfonylphenol |
| SMILES | COc1ccc(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C13H7F5O4S/c1-22-7-3-2-5(4-6(7)19)23(20,21)13-11(17)9(15)8(14)10(16)12(13)18/h2-4,19H,1H3 |
| InChIKey | YBSYSAZPVMYIMI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|