C13H9Cl2FO4S — CID 143476460
4-(2,6-dichloro-4-fluorophenyl)sulfonyl-2-methoxyphenol (PubChem CID 143476460) has the molecular formula C13H9Cl2FO4S and a molecular weight of 351.18 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-fluorophenyl)sulfonyl-2-methoxyphenol.
| Compound Name | 4-(2,6-dichloro-4-fluorophenyl)sulfonyl-2-methoxyphenol |
|---|---|
| PubChem CID | 143476460 |
| Molecular Formula | C13H9Cl2FO4S |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 4-(2,6-dichloro-4-fluorophenyl)sulfonyl-2-methoxyphenol |
| SMILES | COc1cc(S(=O)(=O)c2c(Cl)cc(F)cc2Cl)ccc1O |
| InChI | InChI=1S/C13H9Cl2FO4S/c1-20-12-6-8(2-3-11(12)17)21(18,19)13-9(14)4-7(16)5-10(13)15/h2-6,17H,1H3 |
| InChIKey | FIUOPUBDXGYGKT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |