C19H22F4O — CID 54524925
2-fluoro-4-[4-(4-methylpenta-1,3-dienyl)cyclohexyl]-1-(trifluoromethoxy)benzene (PubChem CID 54524925) has the molecular formula C19H22F4O and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-methylpenta-1,3-dienyl)cyclohexyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-(4-methylpenta-1,3-dienyl)cyclohexyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54524925 |
| Molecular Formula | C19H22F4O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-fluoro-4-[4-(4-methylpenta-1,3-dienyl)cyclohexyl]-1-(trifluoromethoxy)benzene |
| SMILES | CC(C)=CC=CC1CCC(c2ccc(OC(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H22F4O/c1-13(2)4-3-5-14-6-8-15(9-7-14)16-10-11-18(17(20)12-16)24-19(21,22)23/h3-5,10-12,14-15H,6-9H2,1-2H3 |
| InChIKey | YSLVDJAJNSIDEL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|