C20H17NO4S — CID 54525389
[1-(3-sulfamoylphenyl)naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 54525389) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is [1-(3-sulfamoylphenyl)naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(3-sulfamoylphenyl)naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54525389 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [1-(3-sulfamoylphenyl)naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2ccccc2c1-c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H17NO4S/c1-13(2)20(22)25-18-11-10-14-6-3-4-9-17(14)19(18)15-7-5-8-16(12-15)26(21,23)24/h3-12H,1H2,2H3,(H2,21,23,24) |
| InChIKey | YSTMMPKNZIJGPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|