C26H34O4S — CID 54534590
[(10R,13S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate (PubChem CID 54534590) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate.
| Compound Name | [(10R,13S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54534590 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3C4CC=C5CC(=O)CC[C@]5(C)C4CC[C@]23C)cc1 |
| InChI | InChI=1S/C26H34O4S/c1-17-4-7-20(8-5-17)31(28,29)30-24-11-10-22-21-9-6-18-16-19(27)12-14-25(18,2)23(21)13-15-26(22,24)3/h4-8,21-24H,9-16H2,1-3H3/t21?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | YYWXVNAXJSBEEE-RHFPYEFTSA-N |
| XLogP | 5.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|