C4H5Br3O — CID 54535645
2,3,4-tribromobut-2-en-1-ol (PubChem CID 54535645) has the molecular formula C4H5Br3O and a molecular weight of 308.80 g/mol. Its IUPAC name is 2,3,4-tribromobut-2-en-1-ol.
| Compound Name | 2,3,4-tribromobut-2-en-1-ol |
|---|---|
| PubChem CID | 54535645 |
| Molecular Formula | C4H5Br3O |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 305.79 |
| IUPAC Name | 2,3,4-tribromobut-2-en-1-ol |
| SMILES | OCC(Br)=C(Br)CBr |
| InChI | InChI=1S/C4H5Br3O/c5-1-3(6)4(7)2-8/h8H,1-2H2 |
| InChIKey | YZOSORGGVXSBNG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|