C28H55N — CID 54537679
N-butyl-5,5,7,7-tetramethyl-N-(5,5,7,7-tetramethyloct-2-enyl)oct-2-en-1-amine (PubChem CID 54537679) has the molecular formula C28H55N and a molecular weight of 405.76 g/mol. Its IUPAC name is N-butyl-5,5,7,7-tetramethyl-N-(5,5,7,7-tetramethyloct-2-enyl)oct-2-en-1-amine.
| Compound Name | N-butyl-5,5,7,7-tetramethyl-N-(5,5,7,7-tetramethyloct-2-enyl)oct-2-en-1-amine |
|---|---|
| PubChem CID | 54537679 |
| Molecular Formula | C28H55N |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.43 |
| IUPAC Name | N-butyl-5,5,7,7-tetramethyl-N-(5,5,7,7-tetramethyloct-2-enyl)oct-2-en-1-amine |
| SMILES | CCCCN(CC=CCC(C)(C)CC(C)(C)C)CC=CCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C28H55N/c1-12-13-20-29(21-16-14-18-27(8,9)23-25(2,3)4)22-17-15-19-28(10,11)24-26(5,6)7/h14-17H,12-13,18-24H2,1-11H3 |
| InChIKey | ZAYNEGYLQMBZHR-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|