C26H50N6O8 — CID 54543572
tert-butyl N-[N'-(3-aminopropyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;tert-butyl N-[C-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamate (PubChem CID 54543572) has the molecular formula C26H50N6O8 and a molecular weight of 574.72 g/mol. Its IUPAC name is tert-butyl N-[N'-(3-aminopropyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;tert-butyl N-[C-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-(3-aminopropyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;tert-butyl N-[C-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 54543572 |
| Molecular Formula | C26H50N6O8 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | tert-butyl N-[N'-(3-aminopropyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate;tert-butyl N-[C-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]carbamate |
| SMILES | CC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.CC(C)(C)OC(=O)NC(=NCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N4O4.C12H22N2O4/c1-13(2,3)21-11(19)17-10(16-9-7-8-15)18-12(20)22-14(4,5)6;1-8(13-9(15)17-11(2,3)4)14-10(16)18-12(5,6)7/h7-9,15H2,1-6H3,(H2,16,17,18,19,20);1-7H3,(H,13,14,15,16) |
| InChIKey | ZEYWGSKNYLASHZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 192.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|