C5H10N2O4S — CID 54543869
2-methyl-3-(methylamino)-4-oxoazetidine-1-sulfonic acid (PubChem CID 54543869) has the molecular formula C5H10N2O4S and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 2-methyl-3-(methylamino)-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 54543869 |
| Molecular Formula | C5H10N2O4S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-methyl-3-(methylamino)-4-oxoazetidine-1-sulfonic acid |
| SMILES | CNC1C(=O)N(S(=O)(=O)O)C1C |
| InChI | InChI=1S/C5H10N2O4S/c1-3-4(6-2)5(8)7(3)12(9,10)11/h3-4,6H,1-2H3,(H,9,10,11) |
| InChIKey | YPELGJZSTVSZFK-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|