C6H10N2O7S2 — CID 70390987
(2R,3R)-3-acetamido-2-methylsulfonyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 70390987) has the molecular formula C6H10N2O7S2 and a molecular weight of 286.29 g/mol. Its IUPAC name is (2R,3R)-3-acetamido-2-methylsulfonyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2R,3R)-3-acetamido-2-methylsulfonyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70390987 |
| Molecular Formula | C6H10N2O7S2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | (2R,3R)-3-acetamido-2-methylsulfonyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CC(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C6H10N2O7S2/c1-3(9)7-4-5(10)8(17(13,14)15)6(4)16(2,11)12/h4,6H,1-2H3,(H,7,9)(H,13,14,15)/t4-,6-/m1/s1 |
| InChIKey | QUKDIQWSDLBRER-INEUFUBQSA-N |
| XLogP | -2.49 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|