C7H9NO3S — CID 76852082
N-(2-methylsulfanyl-3,4-dioxocyclobutyl)acetamide (PubChem CID 76852082) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is N-(2-methylsulfanyl-3,4-dioxocyclobutyl)acetamide.
| Compound Name | N-(2-methylsulfanyl-3,4-dioxocyclobutyl)acetamide |
|---|---|
| PubChem CID | 76852082 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | N-(2-methylsulfanyl-3,4-dioxocyclobutyl)acetamide |
| SMILES | CSC1C(=O)C(=O)C1NC(C)=O |
| InChI | InChI=1S/C7H9NO3S/c1-3(9)8-4-5(10)6(11)7(4)12-2/h4,7H,1-2H3,(H,8,9) |
| InChIKey | QAVAEEASKDBUSI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|