C8H13NO5 — CID 91847162
N-(2,4-dihydroxy-6-methyl-5-oxooxan-3-yl)acetamide (PubChem CID 91847162) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is N-(2,4-dihydroxy-6-methyl-5-oxooxan-3-yl)acetamide.
| Compound Name | N-(2,4-dihydroxy-6-methyl-5-oxooxan-3-yl)acetamide |
|---|---|
| PubChem CID | 91847162 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | N-(2,4-dihydroxy-6-methyl-5-oxooxan-3-yl)acetamide |
| SMILES | CC(=O)NC1C(O)OC(C)C(=O)C1O |
| InChI | InChI=1S/C8H13NO5/c1-3-6(11)7(12)5(8(13)14-3)9-4(2)10/h3,5,7-8,12-13H,1-2H3,(H,9,10) |
| InChIKey | CBRMPSOALLZPKI-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |