C28H21F3N2O3 — CID 54545090
4-[4,5-bis(4-hydroxyphenyl)-2-phenyl-1-(trifluoromethyl)-3H-pyrazol-3-yl]phenol (PubChem CID 54545090) has the molecular formula C28H21F3N2O3 and a molecular weight of 490.48 g/mol. Its IUPAC name is 4-[4,5-bis(4-hydroxyphenyl)-2-phenyl-1-(trifluoromethyl)-3H-pyrazol-3-yl]phenol.
| Compound Name | 4-[4,5-bis(4-hydroxyphenyl)-2-phenyl-1-(trifluoromethyl)-3H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 54545090 |
| Molecular Formula | C28H21F3N2O3 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 4-[4,5-bis(4-hydroxyphenyl)-2-phenyl-1-(trifluoromethyl)-3H-pyrazol-3-yl]phenol |
| SMILES | Oc1ccc(C2=C(c3ccc(O)cc3)N(C(F)(F)F)N(c3ccccc3)C2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H21F3N2O3/c29-28(30,31)33-27(20-10-16-24(36)17-11-20)25(18-6-12-22(34)13-7-18)26(19-8-14-23(35)15-9-19)32(33)21-4-2-1-3-5-21/h1-17,26,34-36H |
| InChIKey | ZFYRHFNUZAQLIY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|