C12H22F2N2O3 — CID 54545483
4-acetamido-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide (PubChem CID 54545483) has the molecular formula C12H22F2N2O3 and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-acetamido-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide.
| Compound Name | 4-acetamido-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide |
|---|---|
| PubChem CID | 54545483 |
| Molecular Formula | C12H22F2N2O3 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-acetamido-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide |
| SMILES | CCCNC(=O)C(F)(F)C(O)C(NC(C)=O)C(C)C |
| InChI | InChI=1S/C12H22F2N2O3/c1-5-6-15-11(19)12(13,14)10(18)9(7(2)3)16-8(4)17/h7,9-10,18H,5-6H2,1-4H3,(H,15,19)(H,16,17) |
| InChIKey | ZGGFPIZEKLDXJR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |