C7H7ClN2O3S — CID 54547559
2-chloro-N-sulfamoylbenzamide (PubChem CID 54547559) has the molecular formula C7H7ClN2O3S and a molecular weight of 234.66 g/mol. Its IUPAC name is 2-chloro-N-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-sulfamoylbenzamide |
|---|---|
| PubChem CID | 54547559 |
| Molecular Formula | C7H7ClN2O3S |
| Molecular Weight | 234.66 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-chloro-N-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C7H7ClN2O3S/c8-6-4-2-1-3-5(6)7(11)10-14(9,12)13/h1-4H,(H,10,11)(H2,9,12,13) |
| InChIKey | ZHPFIYIEZZBIPD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.66 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |