C24H29NO3 — CID 54547849
(1-carbamoyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) 3-phenylpropanoate (PubChem CID 54547849) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (1-carbamoyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) 3-phenylpropanoate.
| Compound Name | (1-carbamoyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) 3-phenylpropanoate |
|---|---|
| PubChem CID | 54547849 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (1-carbamoyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl) 3-phenylpropanoate |
| SMILES | CC1(C)CCC(C)(C)c2c1ccc(OC(=O)CCc1ccccc1)c2C(N)=O |
| InChI | InChI=1S/C24H29NO3/c1-23(2)14-15-24(3,4)21-17(23)11-12-18(20(21)22(25)27)28-19(26)13-10-16-8-6-5-7-9-16/h5-9,11-12H,10,13-15H2,1-4H3,(H2,25,27) |
| InChIKey | ZHUPRNRXLMHORL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|