C16H22N2O — CID 54553270
2-phenyl-1-(2,3,4,5-tetrahydropyridin-6-ylamino)cyclopentan-1-ol (PubChem CID 54553270) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-phenyl-1-(2,3,4,5-tetrahydropyridin-6-ylamino)cyclopentan-1-ol.
| Compound Name | 2-phenyl-1-(2,3,4,5-tetrahydropyridin-6-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 54553270 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-phenyl-1-(2,3,4,5-tetrahydropyridin-6-ylamino)cyclopentan-1-ol |
| SMILES | OC1(NC2=NCCCC2)CCCC1c1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c19-16(18-15-10-4-5-12-17-15)11-6-9-14(16)13-7-2-1-3-8-13/h1-3,7-8,14,19H,4-6,9-12H2,(H,17,18) |
| InChIKey | ZLJOYRPWCXGJKT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|