3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid

C18H12O6 — CID 54553932

IUPAC3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid
SMILESCc1cc2c(cc1C(=O)O)C(=O)c1c(C)cc(C(=O)O)cc1C2=O
InChIInChI=1S/C18H12O6/c1-7-4-11-12(6-10(7)18(23)24)16(20)14-8(2)3-9(17(21)22)5-13(14)15(11)19/h3-6H,1-2H3,(H,21,22)(H,23,24)
InChIKeyZLVPBSGEVQEBQN-UHFFFAOYSA-N
MW324.29 g/mol
LogP2.48
Rot. Bonds2

About 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid

3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid (PubChem CID 54553932) has the molecular formula C18H12O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid.

Molecular Properties

Compound Name3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid
PubChem CID54553932
Molecular FormulaC18H12O6
Molecular Weight324.29 g/mol
Exact Mass324.06
IUPAC Name3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid
SMILESCc1cc2c(cc1C(=O)O)C(=O)c1c(C)cc(C(=O)O)cc1C2=O
InChIInChI=1S/C18H12O6/c1-7-4-11-12(6-10(7)18(23)24)16(20)14-8(2)3-9(17(21)22)5-13(14)15(11)19/h3-6H,1-2H3,(H,21,22)(H,23,24)
InChIKeyZLVPBSGEVQEBQN-UHFFFAOYSA-N
XLogP2.48
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.29
LogP ≤ 52.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}

Analyze 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid?
The IUPAC name of 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid (CID 54553932) is 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid.
What is the SMILES notation for 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid?
The canonical SMILES for 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid is Cc1cc2c(cc1C(=O)O)C(=O)c1c(C)cc(C(=O)O)cc1C2=O.
What is the InChIKey of 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid?
The InChIKey is ZLVPBSGEVQEBQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O6/c1-7-4-11-12(6-10(7)18(23)24)16(20)14-8(2)3-9(17(21)22)5-13(14)15(11)19/h3-6H,1-2H3,(H,21,22)(H,23,24).
What are the key properties of 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid?
3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid has a molecular weight of 324.29 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid is sourced from PubChem (CID 54553932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).