C18H12O6 — CID 54553932
3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid (PubChem CID 54553932) has the molecular formula C18H12O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid.
| Compound Name | 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 54553932 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3,8-dimethyl-9,10-dioxoanthracene-2,6-dicarboxylic acid |
| SMILES | Cc1cc2c(cc1C(=O)O)C(=O)c1c(C)cc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C18H12O6/c1-7-4-11-12(6-10(7)18(23)24)16(20)14-8(2)3-9(17(21)22)5-13(14)15(11)19/h3-6H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | ZLVPBSGEVQEBQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|