C17H16S — CID 54559860
3-(3,4-dimethylphenyl)-1-phenylprop-2-ene-1-thione (PubChem CID 54559860) has the molecular formula C17H16S and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-phenylprop-2-ene-1-thione.
| Compound Name | 3-(3,4-dimethylphenyl)-1-phenylprop-2-ene-1-thione |
|---|---|
| PubChem CID | 54559860 |
| Molecular Formula | C17H16S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-phenylprop-2-ene-1-thione |
| SMILES | Cc1ccc(C=CC(=S)c2ccccc2)cc1C |
| InChI | InChI=1S/C17H16S/c1-13-8-9-15(12-14(13)2)10-11-17(18)16-6-4-3-5-7-16/h3-12H,1-2H3 |
| InChIKey | ZPTURTVVQHSNPD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|