C28H32N2O3 — CID 54565580
[5-[4-[(2S)-2-methylbutoxy]phenyl]pyrazin-2-yl] 4-hex-5-enylbenzoate (PubChem CID 54565580) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is [5-[4-[(2S)-2-methylbutoxy]phenyl]pyrazin-2-yl] 4-hex-5-enylbenzoate.
| Compound Name | [5-[4-[(2S)-2-methylbutoxy]phenyl]pyrazin-2-yl] 4-hex-5-enylbenzoate |
|---|---|
| PubChem CID | 54565580 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | [5-[4-[(2S)-2-methylbutoxy]phenyl]pyrazin-2-yl] 4-hex-5-enylbenzoate |
| SMILES | C=CCCCCc1ccc(C(=O)Oc2cnc(-c3ccc(OC[C@@H](C)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-4-6-7-8-9-22-10-12-24(13-11-22)28(31)33-27-19-29-26(18-30-27)23-14-16-25(17-15-23)32-20-21(3)5-2/h4,10-19,21H,1,5-9,20H2,2-3H3/t21-/m0/s1 |
| InChIKey | ZTOTVAYRBBCQNI-NRFANRHFSA-N |
| XLogP | 6.69 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|