C20H26N2O4 — CID 54568024
3-hexyl-6-(3-nitrophenyl)-6-propyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 54568024) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-hexyl-6-(3-nitrophenyl)-6-propyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-hexyl-6-(3-nitrophenyl)-6-propyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 54568024 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-hexyl-6-(3-nitrophenyl)-6-propyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CCCCCCn1c(O)c2c(c1O)C2(CCC)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-5-6-7-12-21-18(23)16-17(19(21)24)20(16,11-4-2)14-9-8-10-15(13-14)22(25)26/h8-10,13,23-24H,3-7,11-12H2,1-2H3 |
| InChIKey | ZVFHKFHKJHNNJN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|