C18H19N3O4 — CID 54555246
3-hexyl-2,4-dihydroxy-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-6-carbonitrile (PubChem CID 54555246) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-hexyl-2,4-dihydroxy-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-6-carbonitrile.
| Compound Name | 3-hexyl-2,4-dihydroxy-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-6-carbonitrile |
|---|---|
| PubChem CID | 54555246 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-hexyl-2,4-dihydroxy-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-6-carbonitrile |
| SMILES | CCCCCCn1c(O)c2c(c1O)C2(C#N)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O4/c1-2-3-4-5-9-20-16(22)14-15(17(20)23)18(14,11-19)12-7-6-8-13(10-12)21(24)25/h6-8,10,22-23H,2-5,9H2,1H3 |
| InChIKey | ZMSINPNTBAUCSO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|